| Product Name | Profenofos - API |
| Product Code | DA-P157-a |
| Chemical name | Profenofos |
| Synonyms | Acid O-(4-Bromo-2-chlorophenyl) O-Ethyl S-Propyl Ester; Calofos; Carina; Curacron; Ictacron; O-(4-Bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate; Prowess; Selecron; Tambo; Polycron; Profenophos; O-Ethyl-S-n-propyl-O-(2-chloro-4-bromophenyl)thiophosphate; |
| Impurity | NA |
| CAS Number | 41198-08-7 |
| Alternate CAS # | NA |
| Molecular form | C11H15BrClO3PS |
| Appearance | Clear Pale Yellow Oil |
| Melting Point | NA |
| Mol. Weight | 373.63 |
| Storage | 2-8°C Refrigerator |
| Solubility | NA |
| Stability | NA |
| Category | agricultural products,aromatics,pharmaceutical standards,intermediates,fine chemicals,phosphorylating and phosphitylating agents,sulphur and selenium compounds |
| Boiling Point | NA |
| Applications | NA |
| Dangerous Goods Info | NA |
| References | NA |
| Extra Notes | NA |
| Documents (MSDS) | No Data Available |
| Keywords | NA |
